C19H21FN4O3 — CID 125447195
3-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-N-[(3S)-oxolan-3-yl]benzamide (PubChem CID 125447195) has the molecular formula C19H21FN4O3 and a molecular weight of 372.40 g/mol. Its IUPAC name is 3-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-N-[(3S)-oxolan-3-yl]benzamide.
| Compound Name | 3-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-N-[(3S)-oxolan-3-yl]benzamide |
|---|---|
| PubChem CID | 125447195 |
| Molecular Formula | C19H21FN4O3 |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 3-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-N-[(3S)-oxolan-3-yl]benzamide |
| SMILES | O=C(N[C@H]1CCOC1)c1cccc(-c2ncc(F)c(N3CCOCC3)n2)c1 |
| InChI | InChI=1S/C19H21FN4O3/c20-16-11-21-17(23-18(16)24-5-8-26-9-6-24)13-2-1-3-14(10-13)19(25)22-15-4-7-27-12-15/h1-3,10-11,15H,4-9,12H2,(H,22,25)/t15-/m0/s1 |
| InChIKey | KTZBMKYVNWWFSB-HNNXBMFYSA-N |
| XLogP | 1.64 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |