C15H20FN3O2 — CID 166082493
3-fluoro-N-(oxolan-3-yl)-4-piperazin-1-ylbenzamide (PubChem CID 166082493) has the molecular formula C15H20FN3O2 and a molecular weight of 293.34 g/mol. Its IUPAC name is 3-fluoro-N-(oxolan-3-yl)-4-piperazin-1-ylbenzamide.
| Compound Name | 3-fluoro-N-(oxolan-3-yl)-4-piperazin-1-ylbenzamide |
|---|---|
| PubChem CID | 166082493 |
| Molecular Formula | C15H20FN3O2 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 3-fluoro-N-(oxolan-3-yl)-4-piperazin-1-ylbenzamide |
| SMILES | O=C(NC1CCOC1)c1ccc(N2CCNCC2)c(F)c1 |
| InChI | InChI=1S/C15H20FN3O2/c16-13-9-11(15(20)18-12-3-8-21-10-12)1-2-14(13)19-6-4-17-5-7-19/h1-2,9,12,17H,3-8,10H2,(H,18,20) |
| InChIKey | WHUOGYRCECNTGK-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |