C14H19FN4O2 — CID 171559656
6-fluoro-N-[(3R)-oxolan-3-yl]-5-piperazin-1-ylpyridine-2-carboxamide (PubChem CID 171559656) has the molecular formula C14H19FN4O2 and a molecular weight of 294.33 g/mol. Its IUPAC name is 6-fluoro-N-[(3R)-oxolan-3-yl]-5-piperazin-1-ylpyridine-2-carboxamide.
| Compound Name | 6-fluoro-N-[(3R)-oxolan-3-yl]-5-piperazin-1-ylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 171559656 |
| Molecular Formula | C14H19FN4O2 |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 6-fluoro-N-[(3R)-oxolan-3-yl]-5-piperazin-1-ylpyridine-2-carboxamide |
| SMILES | O=C(N[C@@H]1CCOC1)c1ccc(N2CCNCC2)c(F)n1 |
| InChI | InChI=1S/C14H19FN4O2/c15-13-12(19-6-4-16-5-7-19)2-1-11(18-13)14(20)17-10-3-8-21-9-10/h1-2,10,16H,3-9H2,(H,17,20)/t10-/m1/s1 |
| InChIKey | GKPBVZGHEDGGAM-SNVBAGLBSA-N |
| XLogP | 0.15 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|