C13H21FN4O — CID 168900115
ethane;6-fluoro-N-methyl-5-piperazin-1-ylpyridine-2-carboxamide (PubChem CID 168900115) has the molecular formula C13H21FN4O and a molecular weight of 268.34 g/mol. Its IUPAC name is ethane;6-fluoro-N-methyl-5-piperazin-1-ylpyridine-2-carboxamide.
| Compound Name | ethane;6-fluoro-N-methyl-5-piperazin-1-ylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 168900115 |
| Molecular Formula | C13H21FN4O |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | ethane;6-fluoro-N-methyl-5-piperazin-1-ylpyridine-2-carboxamide |
| SMILES | CC.CNC(=O)c1ccc(N2CCNCC2)c(F)n1 |
| InChI | InChI=1S/C11H15FN4O.C2H6/c1-13-11(17)8-2-3-9(10(12)15-8)16-6-4-14-5-7-16;1-2/h2-3,14H,4-7H2,1H3,(H,13,17);1-2H3 |
| InChIKey | NUBRUFIXMLCJPE-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|