C13H16ClF2N5O — CID 178131806
6-chloro-N-(3,3-difluoroazetidin-1-yl)-5-piperazin-1-ylpyridine-2-carboxamide (PubChem CID 178131806) has the molecular formula C13H16ClF2N5O and a molecular weight of 331.75 g/mol. Its IUPAC name is 6-chloro-N-(3,3-difluoroazetidin-1-yl)-5-piperazin-1-ylpyridine-2-carboxamide.
| Compound Name | 6-chloro-N-(3,3-difluoroazetidin-1-yl)-5-piperazin-1-ylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 178131806 |
| Molecular Formula | C13H16ClF2N5O |
| Molecular Weight | 331.75 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 6-chloro-N-(3,3-difluoroazetidin-1-yl)-5-piperazin-1-ylpyridine-2-carboxamide |
| SMILES | O=C(NN1CC(F)(F)C1)c1ccc(N2CCNCC2)c(Cl)n1 |
| InChI | InChI=1S/C13H16ClF2N5O/c14-11-10(20-5-3-17-4-6-20)2-1-9(18-11)12(22)19-21-7-13(15,16)8-21/h1-2,17H,3-8H2,(H,19,22) |
| InChIKey | ATCDKSJNJMFQHZ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.75 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|