C17H25FN4O3 — CID 177274377
tert-butyl (2S)-4-[2-fluoro-6-(methylcarbamoyl)-3-pyridinyl]-2-methylpiperazine-1-carboxylate (PubChem CID 177274377) has the molecular formula C17H25FN4O3 and a molecular weight of 352.41 g/mol. Its IUPAC name is tert-butyl (2S)-4-[2-fluoro-6-(methylcarbamoyl)-3-pyridinyl]-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2S)-4-[2-fluoro-6-(methylcarbamoyl)-3-pyridinyl]-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 177274377 |
| Molecular Formula | C17H25FN4O3 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | tert-butyl (2S)-4-[2-fluoro-6-(methylcarbamoyl)-3-pyridinyl]-2-methylpiperazine-1-carboxylate |
| SMILES | CNC(=O)c1ccc(N2CCN(C(=O)OC(C)(C)C)[C@@H](C)C2)c(F)n1 |
| InChI | InChI=1S/C17H25FN4O3/c1-11-10-21(8-9-22(11)16(24)25-17(2,3)4)13-7-6-12(15(23)19-5)20-14(13)18/h6-7,11H,8-10H2,1-5H3,(H,19,23)/t11-/m0/s1 |
| InChIKey | LGWVACUTWYRMED-NSHDSACASA-N |
| XLogP | 2.03 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|