C23H31FN6O2 — CID 176560575
5-[4-[1-(5-ethyl-6-oxo-1H-pyridin-2-yl)piperidin-4-yl]piperazin-1-yl]-6-fluoro-N-methylpyridine-2-carboxamide (PubChem CID 176560575) has the molecular formula C23H31FN6O2 and a molecular weight of 442.54 g/mol. Its IUPAC name is 5-[4-[1-(5-ethyl-6-oxo-1H-pyridin-2-yl)piperidin-4-yl]piperazin-1-yl]-6-fluoro-N-methylpyridine-2-carboxamide.
| Compound Name | 5-[4-[1-(5-ethyl-6-oxo-1H-pyridin-2-yl)piperidin-4-yl]piperazin-1-yl]-6-fluoro-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 176560575 |
| Molecular Formula | C23H31FN6O2 |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | 5-[4-[1-(5-ethyl-6-oxo-1H-pyridin-2-yl)piperidin-4-yl]piperazin-1-yl]-6-fluoro-N-methylpyridine-2-carboxamide |
| SMILES | CCc1ccc(N2CCC(N3CCN(c4ccc(C(=O)NC)nc4F)CC3)CC2)[nH]c1=O |
| InChI | InChI=1S/C23H31FN6O2/c1-3-16-4-7-20(27-22(16)31)30-10-8-17(9-11-30)28-12-14-29(15-13-28)19-6-5-18(23(32)25-2)26-21(19)24/h4-7,17H,3,8-15H2,1-2H3,(H,25,32)(H,27,31) |
| InChIKey | IBGSNVWHKBBRNM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|