C24H32FN5O2 — CID 176560384
N-ethyl-5-[4-[(1S,3R)-3-(5-ethyl-6-oxo-1H-pyridin-2-yl)cyclopentyl]piperazin-1-yl]-6-fluoropyridine-2-carboxamide (PubChem CID 176560384) has the molecular formula C24H32FN5O2 and a molecular weight of 441.55 g/mol. Its IUPAC name is N-ethyl-5-[4-[(1S,3R)-3-(5-ethyl-6-oxo-1H-pyridin-2-yl)cyclopentyl]piperazin-1-yl]-6-fluoropyridine-2-carboxamide.
| Compound Name | N-ethyl-5-[4-[(1S,3R)-3-(5-ethyl-6-oxo-1H-pyridin-2-yl)cyclopentyl]piperazin-1-yl]-6-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 176560384 |
| Molecular Formula | C24H32FN5O2 |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | N-ethyl-5-[4-[(1S,3R)-3-(5-ethyl-6-oxo-1H-pyridin-2-yl)cyclopentyl]piperazin-1-yl]-6-fluoropyridine-2-carboxamide |
| SMILES | CCNC(=O)c1ccc(N2CCN([C@H]3CC[C@@H](c4ccc(CC)c(=O)[nH]4)C3)CC2)c(F)n1 |
| InChI | InChI=1S/C24H32FN5O2/c1-3-16-6-8-19(28-23(16)31)17-5-7-18(15-17)29-11-13-30(14-12-29)21-10-9-20(27-22(21)25)24(32)26-4-2/h6,8-10,17-18H,3-5,7,11-15H2,1-2H3,(H,26,32)(H,28,31)/t17-,18+/m1/s1 |
| InChIKey | BFIOPLFGUYAIKX-MSOLQXFVSA-N |
| XLogP | 2.68 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|