C25H27F2N5O5 — CID 176964568
6-fluoro-5-[4-[3-(8-fluoro-1-oxo-2H-isoquinolin-3-yl)cyclopentyl]piperazin-1-yl]-N-(trihydroxymethyl)pyridine-2-carboxamide (PubChem CID 176964568) has the molecular formula C25H27F2N5O5 and a molecular weight of 515.52 g/mol. Its IUPAC name is 6-fluoro-5-[4-[3-(8-fluoro-1-oxo-2H-isoquinolin-3-yl)cyclopentyl]piperazin-1-yl]-N-(trihydroxymethyl)pyridine-2-carboxamide.
| Compound Name | 6-fluoro-5-[4-[3-(8-fluoro-1-oxo-2H-isoquinolin-3-yl)cyclopentyl]piperazin-1-yl]-N-(trihydroxymethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 176964568 |
| Molecular Formula | C25H27F2N5O5 |
| Molecular Weight | 515.52 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | 6-fluoro-5-[4-[3-(8-fluoro-1-oxo-2H-isoquinolin-3-yl)cyclopentyl]piperazin-1-yl]-N-(trihydroxymethyl)pyridine-2-carboxamide |
| SMILES | O=C(NC(O)(O)O)c1ccc(N2CCN(C3CCC(c4cc5cccc(F)c5c(=O)[nH]4)C3)CC2)c(F)n1 |
| InChI | InChI=1S/C25H27F2N5O5/c26-17-3-1-2-15-13-19(29-24(34)21(15)17)14-4-5-16(12-14)31-8-10-32(11-9-31)20-7-6-18(28-22(20)27)23(33)30-25(35,36)37/h1-3,6-7,13-14,16,35-37H,4-5,8-12H2,(H,29,34)(H,30,33) |
| InChIKey | MVKSMAYTXUTQON-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 142.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.52 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|