C23H30ClN5O2 — CID 176560429
6-chloro-5-[4-[(1S,3R)-3-(5-ethyl-6-oxo-1H-pyridin-2-yl)cyclopentyl]piperazin-1-yl]-N-methylpyridine-2-carboxamide (PubChem CID 176560429) has the molecular formula C23H30ClN5O2 and a molecular weight of 443.98 g/mol. Its IUPAC name is 6-chloro-5-[4-[(1S,3R)-3-(5-ethyl-6-oxo-1H-pyridin-2-yl)cyclopentyl]piperazin-1-yl]-N-methylpyridine-2-carboxamide.
| Compound Name | 6-chloro-5-[4-[(1S,3R)-3-(5-ethyl-6-oxo-1H-pyridin-2-yl)cyclopentyl]piperazin-1-yl]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 176560429 |
| Molecular Formula | C23H30ClN5O2 |
| Molecular Weight | 443.98 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 6-chloro-5-[4-[(1S,3R)-3-(5-ethyl-6-oxo-1H-pyridin-2-yl)cyclopentyl]piperazin-1-yl]-N-methylpyridine-2-carboxamide |
| SMILES | CCc1ccc([C@@H]2CC[C@H](N3CCN(c4ccc(C(=O)NC)nc4Cl)CC3)C2)[nH]c1=O |
| InChI | InChI=1S/C23H30ClN5O2/c1-3-15-5-7-18(27-22(15)30)16-4-6-17(14-16)28-10-12-29(13-11-28)20-9-8-19(23(31)25-2)26-21(20)24/h5,7-9,16-17H,3-4,6,10-14H2,1-2H3,(H,25,31)(H,27,30)/t16-,17+/m1/s1 |
| InChIKey | SKHYGHIQTIQHKH-SJORKVTESA-N |
| XLogP | 2.80 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.98 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|