C20H23ClFN5O2 — CID 176560622
5-[4-[3-(5-chloro-6-oxo-1H-pyridin-2-yl)cyclopentyl]piperazin-1-yl]-6-fluoropyridine-2-carboxamide (PubChem CID 176560622) has the molecular formula C20H23ClFN5O2 and a molecular weight of 419.89 g/mol. Its IUPAC name is 5-[4-[3-(5-chloro-6-oxo-1H-pyridin-2-yl)cyclopentyl]piperazin-1-yl]-6-fluoropyridine-2-carboxamide.
| Compound Name | 5-[4-[3-(5-chloro-6-oxo-1H-pyridin-2-yl)cyclopentyl]piperazin-1-yl]-6-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 176560622 |
| Molecular Formula | C20H23ClFN5O2 |
| Molecular Weight | 419.89 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 5-[4-[3-(5-chloro-6-oxo-1H-pyridin-2-yl)cyclopentyl]piperazin-1-yl]-6-fluoropyridine-2-carboxamide |
| SMILES | NC(=O)c1ccc(N2CCN(C3CCC(c4ccc(Cl)c(=O)[nH]4)C3)CC2)c(F)n1 |
| InChI | InChI=1S/C20H23ClFN5O2/c21-14-3-4-15(25-20(14)29)12-1-2-13(11-12)26-7-9-27(10-8-26)17-6-5-16(19(23)28)24-18(17)22/h3-6,12-13H,1-2,7-11H2,(H2,23,28)(H,25,29) |
| InChIKey | NQQIGKFMJGDIBU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.89 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|