C22H27FN6O2 — CID 176560493
5-[4-[5-(5-ethyl-6-oxo-1H-pyrazin-2-yl)-2-bicyclo[3.1.0]hexanyl]piperazin-1-yl]-6-fluoropyridine-2-carboxamide (PubChem CID 176560493) has the molecular formula C22H27FN6O2 and a molecular weight of 426.50 g/mol. Its IUPAC name is 5-[4-[5-(5-ethyl-6-oxo-1H-pyrazin-2-yl)-2-bicyclo[3.1.0]hexanyl]piperazin-1-yl]-6-fluoropyridine-2-carboxamide.
| Compound Name | 5-[4-[5-(5-ethyl-6-oxo-1H-pyrazin-2-yl)-2-bicyclo[3.1.0]hexanyl]piperazin-1-yl]-6-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 176560493 |
| Molecular Formula | C22H27FN6O2 |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 5-[4-[5-(5-ethyl-6-oxo-1H-pyrazin-2-yl)-2-bicyclo[3.1.0]hexanyl]piperazin-1-yl]-6-fluoropyridine-2-carboxamide |
| SMILES | CCc1ncc(C23CCC(N4CCN(c5ccc(C(N)=O)nc5F)CC4)C2C3)[nH]c1=O |
| InChI | InChI=1S/C22H27FN6O2/c1-2-14-21(31)27-18(12-25-14)22-6-5-16(13(22)11-22)28-7-9-29(10-8-28)17-4-3-15(20(24)30)26-19(17)23/h3-4,12-13,16H,2,5-11H2,1H3,(H2,24,30)(H,27,31) |
| InChIKey | TZJYCIQKIJLSIY-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|