C22H31FN6O2 — CID 176560356
5-[4-[4-(5-ethyl-6-oxo-1H-pyrazin-2-yl)pentan-2-yl]piperazin-1-yl]-6-fluoro-N-methylpyridine-2-carboxamide (PubChem CID 176560356) has the molecular formula C22H31FN6O2 and a molecular weight of 430.53 g/mol. Its IUPAC name is 5-[4-[4-(5-ethyl-6-oxo-1H-pyrazin-2-yl)pentan-2-yl]piperazin-1-yl]-6-fluoro-N-methylpyridine-2-carboxamide.
| Compound Name | 5-[4-[4-(5-ethyl-6-oxo-1H-pyrazin-2-yl)pentan-2-yl]piperazin-1-yl]-6-fluoro-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 176560356 |
| Molecular Formula | C22H31FN6O2 |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | 5-[4-[4-(5-ethyl-6-oxo-1H-pyrazin-2-yl)pentan-2-yl]piperazin-1-yl]-6-fluoro-N-methylpyridine-2-carboxamide |
| SMILES | CCc1ncc(C(C)CC(C)N2CCN(c3ccc(C(=O)NC)nc3F)CC2)[nH]c1=O |
| InChI | InChI=1S/C22H31FN6O2/c1-5-16-22(31)27-18(13-25-16)14(2)12-15(3)28-8-10-29(11-9-28)19-7-6-17(21(30)24-4)26-20(19)23/h6-7,13-15H,5,8-12H2,1-4H3,(H,24,30)(H,27,31) |
| InChIKey | YNARUNLUAPEUNP-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|