C13H16F3N3O — CID 172768945
N-methyl-5-piperidin-1-yl-6-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 172768945) has the molecular formula C13H16F3N3O and a molecular weight of 287.29 g/mol. Its IUPAC name is N-methyl-5-piperidin-1-yl-6-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-methyl-5-piperidin-1-yl-6-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 172768945 |
| Molecular Formula | C13H16F3N3O |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | N-methyl-5-piperidin-1-yl-6-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | CNC(=O)c1ccc(N2CCCCC2)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C13H16F3N3O/c1-17-12(20)9-5-6-10(11(18-9)13(14,15)16)19-7-3-2-4-8-19/h5-6H,2-4,7-8H2,1H3,(H,17,20) |
| InChIKey | MRPDZPFCSPOZKO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |