C15H22F3N5O — CID 162729808
(Z)-3-amino-2-[amino(methyl)amino]-3-[5-piperidin-1-yl-6-(trifluoromethyl)-2-pyridinyl]prop-2-en-1-ol (PubChem CID 162729808) has the molecular formula C15H22F3N5O and a molecular weight of 345.37 g/mol. Its IUPAC name is (Z)-3-amino-2-[amino(methyl)amino]-3-[5-piperidin-1-yl-6-(trifluoromethyl)-2-pyridinyl]prop-2-en-1-ol.
| Compound Name | (Z)-3-amino-2-[amino(methyl)amino]-3-[5-piperidin-1-yl-6-(trifluoromethyl)-2-pyridinyl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 162729808 |
| Molecular Formula | C15H22F3N5O |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | (Z)-3-amino-2-[amino(methyl)amino]-3-[5-piperidin-1-yl-6-(trifluoromethyl)-2-pyridinyl]prop-2-en-1-ol |
| SMILES | CN(N)/C(CO)=C(\N)c1ccc(N2CCCCC2)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C15H22F3N5O/c1-22(20)12(9-24)13(19)10-5-6-11(14(21-10)15(16,17)18)23-7-3-2-4-8-23/h5-6,24H,2-4,7-9,19-20H2,1H3/b13-12- |
| InChIKey | AISULLNFOJXPNV-SEYXRHQNSA-N |
| XLogP | 1.52 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|