C12H17F3N4 — CID 177168012
1-methyl-1-[6-piperidin-1-yl-5-(trifluoromethyl)-2-pyridinyl]hydrazine (PubChem CID 177168012) has the molecular formula C12H17F3N4 and a molecular weight of 274.29 g/mol. Its IUPAC name is 1-methyl-1-[6-piperidin-1-yl-5-(trifluoromethyl)-2-pyridinyl]hydrazine.
| Compound Name | 1-methyl-1-[6-piperidin-1-yl-5-(trifluoromethyl)-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 177168012 |
| Molecular Formula | C12H17F3N4 |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 1-methyl-1-[6-piperidin-1-yl-5-(trifluoromethyl)-2-pyridinyl]hydrazine |
| SMILES | CN(N)c1ccc(C(F)(F)F)c(N2CCCCC2)n1 |
| InChI | InChI=1S/C12H17F3N4/c1-18(16)10-6-5-9(12(13,14)15)11(17-10)19-7-3-2-4-8-19/h5-6H,2-4,7-8,16H2,1H3 |
| InChIKey | CTDVMKGHTQROGF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|