C12H15F5N4 — CID 177168089
1-[6-(3,3-difluoropiperidin-1-yl)-5-(trifluoromethyl)-2-pyridinyl]-1-methylhydrazine (PubChem CID 177168089) has the molecular formula C12H15F5N4 and a molecular weight of 310.27 g/mol. Its IUPAC name is 1-[6-(3,3-difluoropiperidin-1-yl)-5-(trifluoromethyl)-2-pyridinyl]-1-methylhydrazine.
| Compound Name | 1-[6-(3,3-difluoropiperidin-1-yl)-5-(trifluoromethyl)-2-pyridinyl]-1-methylhydrazine |
|---|---|
| PubChem CID | 177168089 |
| Molecular Formula | C12H15F5N4 |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 1-[6-(3,3-difluoropiperidin-1-yl)-5-(trifluoromethyl)-2-pyridinyl]-1-methylhydrazine |
| SMILES | CN(N)c1ccc(C(F)(F)F)c(N2CCCC(F)(F)C2)n1 |
| InChI | InChI=1S/C12H15F5N4/c1-20(18)9-4-3-8(12(15,16)17)10(19-9)21-6-2-5-11(13,14)7-21/h3-4H,2,5-7,18H2,1H3 |
| InChIKey | YLSRCGZYTLKMPL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|