C20H22F5N5O — CID 165402834
(3R)-1-[4-[[4-(3,3-difluoropyrrolidin-1-yl)-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]piperidin-3-ol (PubChem CID 165402834) has the molecular formula C20H22F5N5O and a molecular weight of 443.42 g/mol. Its IUPAC name is (3R)-1-[4-[[4-(3,3-difluoropyrrolidin-1-yl)-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]piperidin-3-ol.
| Compound Name | (3R)-1-[4-[[4-(3,3-difluoropyrrolidin-1-yl)-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]piperidin-3-ol |
|---|---|
| PubChem CID | 165402834 |
| Molecular Formula | C20H22F5N5O |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | (3R)-1-[4-[[4-(3,3-difluoropyrrolidin-1-yl)-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]piperidin-3-ol |
| SMILES | O[C@@H]1CCCN(c2ccc(Nc3ncc(C(F)(F)F)c(N4CCC(F)(F)C4)n3)cc2)C1 |
| InChI | InChI=1S/C20H22F5N5O/c21-19(22)7-9-30(12-19)17-16(20(23,24)25)10-26-18(28-17)27-13-3-5-14(6-4-13)29-8-1-2-15(31)11-29/h3-6,10,15,31H,1-2,7-9,11-12H2,(H,26,27,28)/t15-/m1/s1 |
| InChIKey | CHZUNGCEMSHICO-OAHLLOKOSA-N |
| XLogP | 4.05 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|