C19H24F3N5S — CID 170953905
N-[4-(ethylaminosulfanyl)phenyl]-4-(3-methylpiperidin-1-yl)-5-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 170953905) has the molecular formula C19H24F3N5S and a molecular weight of 411.50 g/mol. Its IUPAC name is N-[4-(ethylaminosulfanyl)phenyl]-4-(3-methylpiperidin-1-yl)-5-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | N-[4-(ethylaminosulfanyl)phenyl]-4-(3-methylpiperidin-1-yl)-5-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 170953905 |
| Molecular Formula | C19H24F3N5S |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | N-[4-(ethylaminosulfanyl)phenyl]-4-(3-methylpiperidin-1-yl)-5-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | CCNSc1ccc(Nc2ncc(C(F)(F)F)c(N3CCCC(C)C3)n2)cc1 |
| InChI | InChI=1S/C19H24F3N5S/c1-3-24-28-15-8-6-14(7-9-15)25-18-23-11-16(19(20,21)22)17(26-18)27-10-4-5-13(2)12-27/h6-9,11,13,24H,3-5,10,12H2,1-2H3,(H,23,25,26) |
| InChIKey | ZKEWEQOLJOQEME-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|