C19H24F3N5O3S — CID 170952507
[5-(methylaminosulfanyl)-2-[[4-(3-methylpiperidin-1-yl)-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]methanetriol (PubChem CID 170952507) has the molecular formula C19H24F3N5O3S and a molecular weight of 459.49 g/mol. Its IUPAC name is [5-(methylaminosulfanyl)-2-[[4-(3-methylpiperidin-1-yl)-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]methanetriol.
| Compound Name | [5-(methylaminosulfanyl)-2-[[4-(3-methylpiperidin-1-yl)-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]methanetriol |
|---|---|
| PubChem CID | 170952507 |
| Molecular Formula | C19H24F3N5O3S |
| Molecular Weight | 459.49 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | [5-(methylaminosulfanyl)-2-[[4-(3-methylpiperidin-1-yl)-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]methanetriol |
| SMILES | CNSc1ccc(Nc2ncc(C(F)(F)F)c(N3CCCC(C)C3)n2)c(C(O)(O)O)c1 |
| InChI | InChI=1S/C19H24F3N5O3S/c1-11-4-3-7-27(10-11)16-14(18(20,21)22)9-24-17(26-16)25-15-6-5-12(31-23-2)8-13(15)19(28,29)30/h5-6,8-9,11,23,28-30H,3-4,7,10H2,1-2H3,(H,24,25,26) |
| InChIKey | GPXRQCASXUFSCB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 113.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|