C22H28F3N5O — CID 165402825
1-[4-[[4-(2,3-dimethylpyrrolidin-1-yl)-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]piperidin-3-ol (PubChem CID 165402825) has the molecular formula C22H28F3N5O and a molecular weight of 435.49 g/mol. Its IUPAC name is 1-[4-[[4-(2,3-dimethylpyrrolidin-1-yl)-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]piperidin-3-ol.
| Compound Name | 1-[4-[[4-(2,3-dimethylpyrrolidin-1-yl)-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]piperidin-3-ol |
|---|---|
| PubChem CID | 165402825 |
| Molecular Formula | C22H28F3N5O |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 1-[4-[[4-(2,3-dimethylpyrrolidin-1-yl)-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]piperidin-3-ol |
| SMILES | CC1CCN(c2nc(Nc3ccc(N4CCCC(O)C4)cc3)ncc2C(F)(F)F)C1C |
| InChI | InChI=1S/C22H28F3N5O/c1-14-9-11-30(15(14)2)20-19(22(23,24)25)12-26-21(28-20)27-16-5-7-17(8-6-16)29-10-3-4-18(31)13-29/h5-8,12,14-15,18,31H,3-4,9-11,13H2,1-2H3,(H,26,27,28) |
| InChIKey | MYDIVJRENZBNSJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|