C17H19F3N4O2 — CID 177168201
3-methyl-1-[methyl-[6-piperidin-1-yl-5-(trifluoromethyl)-2-pyridinyl]amino]pyrrole-2,5-dione (PubChem CID 177168201) has the molecular formula C17H19F3N4O2 and a molecular weight of 368.36 g/mol. Its IUPAC name is 3-methyl-1-[methyl-[6-piperidin-1-yl-5-(trifluoromethyl)-2-pyridinyl]amino]pyrrole-2,5-dione.
| Compound Name | 3-methyl-1-[methyl-[6-piperidin-1-yl-5-(trifluoromethyl)-2-pyridinyl]amino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 177168201 |
| Molecular Formula | C17H19F3N4O2 |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 3-methyl-1-[methyl-[6-piperidin-1-yl-5-(trifluoromethyl)-2-pyridinyl]amino]pyrrole-2,5-dione |
| SMILES | CC1=CC(=O)N(N(C)c2ccc(C(F)(F)F)c(N3CCCCC3)n2)C1=O |
| InChI | InChI=1S/C17H19F3N4O2/c1-11-10-14(25)24(16(11)26)22(2)13-7-6-12(17(18,19)20)15(21-13)23-8-4-3-5-9-23/h6-7,10H,3-5,8-9H2,1-2H3 |
| InChIKey | ZKAJBSNBUIYNFJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|