About N-cyclopropyl-5-(2,5-diazabicyclo[4.2.0]octan-2-yl)-6-fluoropyridine-2-carboxamide
N-cyclopropyl-5-(2,5-diazabicyclo[4.2.0]octan-2-yl)-6-fluoropyridine-2-carboxamide (PubChem CID 170057183) has the molecular formula C15H19FN4O
and a molecular weight of 290.34 g/mol. Its IUPAC name is N-cyclopropyl-5-(2,5-diazabicyclo[4.2.0]octan-2-yl)-6-fluoropyridine-2-carboxamide.
Molecular Properties
| Compound Name | N-cyclopropyl-5-(2,5-diazabicyclo[4.2.0]octan-2-yl)-6-fluoropyridine-2-carboxamide |
| PubChem CID | 170057183 |
| Molecular Formula | C15H19FN4O |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | N-cyclopropyl-5-(2,5-diazabicyclo[4.2.0]octan-2-yl)-6-fluoropyridine-2-carboxamide |
| SMILES | O=C(NC1CC1)c1ccc(N2CCNC3CCC32)c(F)n1 |
| InChI | InChI=1S/C15H19FN4O/c16-14-13(20-8-7-17-10-3-5-12(10)20)6-4-11(19-14)15(21)18-9-1-2-9/h4,6,9-10,12,17H,1-3,5,7-8H2,(H,18,21) |
| InChIKey | FVRSXQWJJUIHSE-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopropyl-5-(2,5-diazabicyclo[4.2.0]octan-2-yl)-6-fluoropyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-5-(2,5-diazabicyclo[4.2.0]octan-2-yl)-6-fluoropyridine-2-carboxamide?
The IUPAC name of N-cyclopropyl-5-(2,5-diazabicyclo[4.2.0]octan-2-yl)-6-fluoropyridine-2-carboxamide (CID 170057183) is N-cyclopropyl-5-(2,5-diazabicyclo[4.2.0]octan-2-yl)-6-fluoropyridine-2-carboxamide.
What is the SMILES notation for N-cyclopropyl-5-(2,5-diazabicyclo[4.2.0]octan-2-yl)-6-fluoropyridine-2-carboxamide?
The canonical SMILES for N-cyclopropyl-5-(2,5-diazabicyclo[4.2.0]octan-2-yl)-6-fluoropyridine-2-carboxamide is O=C(NC1CC1)c1ccc(N2CCNC3CCC32)c(F)n1.
What is the InChIKey of N-cyclopropyl-5-(2,5-diazabicyclo[4.2.0]octan-2-yl)-6-fluoropyridine-2-carboxamide?
The InChIKey is FVRSXQWJJUIHSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19FN4O/c16-14-13(20-8-7-17-10-3-5-12(10)20)6-4-11(19-14)15(21)18-9-1-2-9/h4,6,9-10,12,17H,1-3,5,7-8H2,(H,18,21).
What are the key properties of N-cyclopropyl-5-(2,5-diazabicyclo[4.2.0]octan-2-yl)-6-fluoropyridine-2-carboxamide?
N-cyclopropyl-5-(2,5-diazabicyclo[4.2.0]octan-2-yl)-6-fluoropyridine-2-carboxamide has a molecular weight of 290.34 g/mol, XLogP of 1.05, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-5-(2,5-diazabicyclo[4.2.0]octan-2-yl)-6-fluoropyridine-2-carboxamide is sourced from PubChem (CID 170057183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).