C15H19FN4O — CID 170057183
N-cyclopropyl-5-(2,5-diazabicyclo[4.2.0]octan-2-yl)-6-fluoropyridine-2-carboxamide (PubChem CID 170057183) has the molecular formula C15H19FN4O and a molecular weight of 290.34 g/mol. Its IUPAC name is N-cyclopropyl-5-(2,5-diazabicyclo[4.2.0]octan-2-yl)-6-fluoropyridine-2-carboxamide.
| Compound Name | N-cyclopropyl-5-(2,5-diazabicyclo[4.2.0]octan-2-yl)-6-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 170057183 |
| Molecular Formula | C15H19FN4O |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | N-cyclopropyl-5-(2,5-diazabicyclo[4.2.0]octan-2-yl)-6-fluoropyridine-2-carboxamide |
| SMILES | O=C(NC1CC1)c1ccc(N2CCNC3CCC32)c(F)n1 |
| InChI | InChI=1S/C15H19FN4O/c16-14-13(20-8-7-17-10-3-5-12(10)20)6-4-11(19-14)15(21)18-9-1-2-9/h4,6,9-10,12,17H,1-3,5,7-8H2,(H,18,21) |
| InChIKey | FVRSXQWJJUIHSE-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|