C10H6ClN5O2SSe — CID 61051628
N-(2,1,3-benzoselenadiazol-4-yl)-2-chloropyrimidine-5-sulfonamide (PubChem CID 61051628) has the molecular formula C10H6ClN5O2SSe and a molecular weight of 374.67 g/mol. Its IUPAC name is N-(2,1,3-benzoselenadiazol-4-yl)-2-chloropyrimidine-5-sulfonamide.
| Compound Name | N-(2,1,3-benzoselenadiazol-4-yl)-2-chloropyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 61051628 |
| Molecular Formula | C10H6ClN5O2SSe |
| Molecular Weight | 374.67 g/mol |
| Exact Mass | 374.91 |
| IUPAC Name | N-(2,1,3-benzoselenadiazol-4-yl)-2-chloropyrimidine-5-sulfonamide |
| SMILES | O=S(=O)(Nc1cccc2n[se]nc12)c1cnc(Cl)nc1 |
| InChI | InChI=1S/C10H6ClN5O2SSe/c11-10-12-4-6(5-13-10)19(17,18)14-7-2-1-3-8-9(7)16-20-15-8/h1-5,14H |
| InChIKey | BAXTUQXVHDRIGZ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 97.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.67 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|