C12H7ClN2O4S2 — CID 61027646
5-[(5-chloro-2-cyanophenyl)sulfamoyl]thiophene-2-carboxylic acid (PubChem CID 61027646) has the molecular formula C12H7ClN2O4S2 and a molecular weight of 342.79 g/mol. Its IUPAC name is 5-[(5-chloro-2-cyanophenyl)sulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[(5-chloro-2-cyanophenyl)sulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 61027646 |
| Molecular Formula | C12H7ClN2O4S2 |
| Molecular Weight | 342.79 g/mol |
| Exact Mass | 341.95 |
| IUPAC Name | 5-[(5-chloro-2-cyanophenyl)sulfamoyl]thiophene-2-carboxylic acid |
| SMILES | N#Cc1ccc(Cl)cc1NS(=O)(=O)c1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C12H7ClN2O4S2/c13-8-2-1-7(6-14)9(5-8)15-21(18,19)11-4-3-10(20-11)12(16)17/h1-5,15H,(H,16,17) |
| InChIKey | NDYCTYGEGLGWBK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.79 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |