C11H8F3NO3S2 — CID 107971341
4-(hydroxymethyl)-N-(2,3,4-trifluorophenyl)thiophene-2-sulfonamide (PubChem CID 107971341) has the molecular formula C11H8F3NO3S2 and a molecular weight of 323.32 g/mol. Its IUPAC name is 4-(hydroxymethyl)-N-(2,3,4-trifluorophenyl)thiophene-2-sulfonamide.
| Compound Name | 4-(hydroxymethyl)-N-(2,3,4-trifluorophenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 107971341 |
| Molecular Formula | C11H8F3NO3S2 |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 322.99 |
| IUPAC Name | 4-(hydroxymethyl)-N-(2,3,4-trifluorophenyl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(F)c(F)c1F)c1cc(CO)cs1 |
| InChI | InChI=1S/C11H8F3NO3S2/c12-7-1-2-8(11(14)10(7)13)15-20(17,18)9-3-6(4-16)5-19-9/h1-3,5,15-16H,4H2 |
| InChIKey | DPWXOWLXKGWMGY-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|