C14H17FN2O2S2 — CID 106018431
4-(ethylaminomethyl)-N-(3-fluoro-2-methylphenyl)thiophene-2-sulfonamide (PubChem CID 106018431) has the molecular formula C14H17FN2O2S2 and a molecular weight of 328.43 g/mol. Its IUPAC name is 4-(ethylaminomethyl)-N-(3-fluoro-2-methylphenyl)thiophene-2-sulfonamide.
| Compound Name | 4-(ethylaminomethyl)-N-(3-fluoro-2-methylphenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106018431 |
| Molecular Formula | C14H17FN2O2S2 |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 4-(ethylaminomethyl)-N-(3-fluoro-2-methylphenyl)thiophene-2-sulfonamide |
| SMILES | CCNCc1csc(S(=O)(=O)Nc2cccc(F)c2C)c1 |
| InChI | InChI=1S/C14H17FN2O2S2/c1-3-16-8-11-7-14(20-9-11)21(18,19)17-13-6-4-5-12(15)10(13)2/h4-7,9,16-17H,3,8H2,1-2H3 |
| InChIKey | QPJMRSMBSUAEAQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |