C12H14BrN3O2S2 — CID 106076005
N-(3-bromo-4-pyridinyl)-4-(ethylaminomethyl)thiophene-2-sulfonamide (PubChem CID 106076005) has the molecular formula C12H14BrN3O2S2 and a molecular weight of 376.30 g/mol. Its IUPAC name is N-(3-bromo-4-pyridinyl)-4-(ethylaminomethyl)thiophene-2-sulfonamide.
| Compound Name | N-(3-bromo-4-pyridinyl)-4-(ethylaminomethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106076005 |
| Molecular Formula | C12H14BrN3O2S2 |
| Molecular Weight | 376.30 g/mol |
| Exact Mass | 374.97 |
| IUPAC Name | N-(3-bromo-4-pyridinyl)-4-(ethylaminomethyl)thiophene-2-sulfonamide |
| SMILES | CCNCc1csc(S(=O)(=O)Nc2ccncc2Br)c1 |
| InChI | InChI=1S/C12H14BrN3O2S2/c1-2-14-6-9-5-12(19-8-9)20(17,18)16-11-3-4-15-7-10(11)13/h3-5,7-8,14H,2,6H2,1H3,(H,15,16) |
| InChIKey | RQOOZGTWCOSDAS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |