C12H10F3NO3S2 — CID 107980210
2-(hydroxymethyl)-4-methyl-N-(2,3,4-trifluorophenyl)thiophene-3-sulfonamide (PubChem CID 107980210) has the molecular formula C12H10F3NO3S2 and a molecular weight of 337.34 g/mol. Its IUPAC name is 2-(hydroxymethyl)-4-methyl-N-(2,3,4-trifluorophenyl)thiophene-3-sulfonamide.
| Compound Name | 2-(hydroxymethyl)-4-methyl-N-(2,3,4-trifluorophenyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 107980210 |
| Molecular Formula | C12H10F3NO3S2 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.01 |
| IUPAC Name | 2-(hydroxymethyl)-4-methyl-N-(2,3,4-trifluorophenyl)thiophene-3-sulfonamide |
| SMILES | Cc1csc(CO)c1S(=O)(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C12H10F3NO3S2/c1-6-5-20-9(4-17)12(6)21(18,19)16-8-3-2-7(13)10(14)11(8)15/h2-3,5,16-17H,4H2,1H3 |
| InChIKey | KHSPHGRIXNRCPM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|