C12H17N3O3S2 — CID 106000617
N-(3-ethyl-1-methylpyrazol-4-yl)-2-(hydroxymethyl)-4-methylthiophene-3-sulfonamide (PubChem CID 106000617) has the molecular formula C12H17N3O3S2 and a molecular weight of 315.42 g/mol. Its IUPAC name is N-(3-ethyl-1-methylpyrazol-4-yl)-2-(hydroxymethyl)-4-methylthiophene-3-sulfonamide.
| Compound Name | N-(3-ethyl-1-methylpyrazol-4-yl)-2-(hydroxymethyl)-4-methylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106000617 |
| Molecular Formula | C12H17N3O3S2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | N-(3-ethyl-1-methylpyrazol-4-yl)-2-(hydroxymethyl)-4-methylthiophene-3-sulfonamide |
| SMILES | CCc1nn(C)cc1NS(=O)(=O)c1c(C)csc1CO |
| InChI | InChI=1S/C12H17N3O3S2/c1-4-9-10(5-15(3)13-9)14-20(17,18)12-8(2)7-19-11(12)6-16/h5,7,14,16H,4,6H2,1-3H3 |
| InChIKey | MEQLXPHIWAMDIR-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |