C14H12ClNO3S2 — CID 60814924
5-chloro-N-[4-(3-hydroxyprop-1-ynyl)-3-methylphenyl]thiophene-2-sulfonamide (PubChem CID 60814924) has the molecular formula C14H12ClNO3S2 and a molecular weight of 341.84 g/mol. Its IUPAC name is 5-chloro-N-[4-(3-hydroxyprop-1-ynyl)-3-methylphenyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[4-(3-hydroxyprop-1-ynyl)-3-methylphenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 60814924 |
| Molecular Formula | C14H12ClNO3S2 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | 5-chloro-N-[4-(3-hydroxyprop-1-ynyl)-3-methylphenyl]thiophene-2-sulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(Cl)s2)ccc1C#CCO |
| InChI | InChI=1S/C14H12ClNO3S2/c1-10-9-12(5-4-11(10)3-2-8-17)16-21(18,19)14-7-6-13(15)20-14/h4-7,9,16-17H,8H2,1H3 |
| InChIKey | ZKVLJZJMJYKMRG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|