C14H10Cl2N2O4S4 — CID 175435734
2-chloro-5-[4-[(5-chlorothiophen-2-yl)sulfonylamino]-N-sulfinoanilino]thiophene (PubChem CID 175435734) has the molecular formula C14H10Cl2N2O4S4 and a molecular weight of 469.42 g/mol. Its IUPAC name is 2-chloro-5-[4-[(5-chlorothiophen-2-yl)sulfonylamino]-N-sulfinoanilino]thiophene.
| Compound Name | 2-chloro-5-[4-[(5-chlorothiophen-2-yl)sulfonylamino]-N-sulfinoanilino]thiophene |
|---|---|
| PubChem CID | 175435734 |
| Molecular Formula | C14H10Cl2N2O4S4 |
| Molecular Weight | 469.42 g/mol |
| Exact Mass | 467.89 |
| IUPAC Name | 2-chloro-5-[4-[(5-chlorothiophen-2-yl)sulfonylamino]-N-sulfinoanilino]thiophene |
| SMILES | O=S(O)N(c1ccc(NS(=O)(=O)c2ccc(Cl)s2)cc1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C14H10Cl2N2O4S4/c15-11-5-7-13(23-11)18(25(19)20)10-3-1-9(2-4-10)17-26(21,22)14-8-6-12(16)24-14/h1-8,17H,(H,19,20) |
| InChIKey | RENARCVGOOHXQL-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.42 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|