C13H12ClNO3S2 — CID 41340918
2-(5-chlorothiophen-2-yl)-N-(4-methylsulfonylphenyl)acetamide (PubChem CID 41340918) has the molecular formula C13H12ClNO3S2 and a molecular weight of 329.83 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)-N-(4-methylsulfonylphenyl)acetamide.
| Compound Name | 2-(5-chlorothiophen-2-yl)-N-(4-methylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 41340918 |
| Molecular Formula | C13H12ClNO3S2 |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 328.99 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)-N-(4-methylsulfonylphenyl)acetamide |
| SMILES | CS(=O)(=O)c1ccc(NC(=O)Cc2ccc(Cl)s2)cc1 |
| InChI | InChI=1S/C13H12ClNO3S2/c1-20(17,18)11-5-2-9(3-6-11)15-13(16)8-10-4-7-12(14)19-10/h2-7H,8H2,1H3,(H,15,16) |
| InChIKey | OTHCUXKPRVCYSK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |