C14H13F3N2O4S — CID 91644693
N-[4-cyano-3-(trifluoromethyl)phenyl]sulfonyl-5-methyloxolane-2-carboxamide (PubChem CID 91644693) has the molecular formula C14H13F3N2O4S and a molecular weight of 362.33 g/mol. Its IUPAC name is N-[4-cyano-3-(trifluoromethyl)phenyl]sulfonyl-5-methyloxolane-2-carboxamide.
| Compound Name | N-[4-cyano-3-(trifluoromethyl)phenyl]sulfonyl-5-methyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 91644693 |
| Molecular Formula | C14H13F3N2O4S |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | N-[4-cyano-3-(trifluoromethyl)phenyl]sulfonyl-5-methyloxolane-2-carboxamide |
| SMILES | CC1CCC(C(=O)NS(=O)(=O)c2ccc(C#N)c(C(F)(F)F)c2)O1 |
| InChI | InChI=1S/C14H13F3N2O4S/c1-8-2-5-12(23-8)13(20)19-24(21,22)10-4-3-9(7-18)11(6-10)14(15,16)17/h3-4,6,8,12H,2,5H2,1H3,(H,19,20) |
| InChIKey | KGCJBLZVMSZEBX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |