C11H19N3O4S2 — CID 43546293
4-(1-aminoethyl)-N-[2-(methanesulfonamido)ethyl]benzenesulfonamide (PubChem CID 43546293) has the molecular formula C11H19N3O4S2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 4-(1-aminoethyl)-N-[2-(methanesulfonamido)ethyl]benzenesulfonamide.
| Compound Name | 4-(1-aminoethyl)-N-[2-(methanesulfonamido)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 43546293 |
| Molecular Formula | C11H19N3O4S2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 4-(1-aminoethyl)-N-[2-(methanesulfonamido)ethyl]benzenesulfonamide |
| SMILES | CC(N)c1ccc(S(=O)(=O)NCCNS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C11H19N3O4S2/c1-9(12)10-3-5-11(6-4-10)20(17,18)14-8-7-13-19(2,15)16/h3-6,9,13-14H,7-8,12H2,1-2H3 |
| InChIKey | CMBPRIUJLWNDFN-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|