C14H19BrN2O — CID 112620091
5-[4-bromo-2-methyl-6-(methylaminomethyl)phenoxy]pentanenitrile (PubChem CID 112620091) has the molecular formula C14H19BrN2O and a molecular weight of 311.22 g/mol. Its IUPAC name is 5-[4-bromo-2-methyl-6-(methylaminomethyl)phenoxy]pentanenitrile.
| Compound Name | 5-[4-bromo-2-methyl-6-(methylaminomethyl)phenoxy]pentanenitrile |
|---|---|
| PubChem CID | 112620091 |
| Molecular Formula | C14H19BrN2O |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 5-[4-bromo-2-methyl-6-(methylaminomethyl)phenoxy]pentanenitrile |
| SMILES | CNCc1cc(Br)cc(C)c1OCCCCC#N |
| InChI | InChI=1S/C14H19BrN2O/c1-11-8-13(15)9-12(10-17-2)14(11)18-7-5-3-4-6-16/h8-9,17H,3-5,7,10H2,1-2H3 |
| InChIKey | OCPIYNREOUGASW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|