C9H7Cl5O — CID 607333
1,2,4-trichloro-5-(2,3-dichloropropoxy)benzene (PubChem CID 607333) has the molecular formula C9H7Cl5O and a molecular weight of 308.42 g/mol. Its IUPAC name is 1,2,4-trichloro-5-(2,3-dichloropropoxy)benzene.
| Compound Name | 1,2,4-trichloro-5-(2,3-dichloropropoxy)benzene |
|---|---|
| PubChem CID | 607333 |
| Molecular Formula | C9H7Cl5O |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 305.89 |
| IUPAC Name | 1,2,4-trichloro-5-(2,3-dichloropropoxy)benzene |
| SMILES | ClCC(Cl)COc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C9H7Cl5O/c10-3-5(11)4-15-9-2-7(13)6(12)1-8(9)14/h1-2,5H,3-4H2 |
| InChIKey | PZQNIZNKFJOAAZ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|