C16H16Cl4O4 — CID 175162598
1-chloro-1-phenoxyethanol;2-(2,4,5-trichlorophenoxy)ethanol (PubChem CID 175162598) has the molecular formula C16H16Cl4O4 and a molecular weight of 414.11 g/mol. Its IUPAC name is 1-chloro-1-phenoxyethanol;2-(2,4,5-trichlorophenoxy)ethanol.
| Compound Name | 1-chloro-1-phenoxyethanol;2-(2,4,5-trichlorophenoxy)ethanol |
|---|---|
| PubChem CID | 175162598 |
| Molecular Formula | C16H16Cl4O4 |
| Molecular Weight | 414.11 g/mol |
| Exact Mass | 411.98 |
| IUPAC Name | 1-chloro-1-phenoxyethanol;2-(2,4,5-trichlorophenoxy)ethanol |
| SMILES | CC(O)(Cl)Oc1ccccc1.OCCOc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C8H7Cl3O2.C8H9ClO2/c9-5-3-7(11)8(4-6(5)10)13-2-1-12;1-8(9,10)11-7-5-3-2-4-6-7/h3-4,12H,1-2H2;2-6,10H,1H3 |
| InChIKey | SPJGGUGJHSIPEO-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.11 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|