C14H18ClNO4 — CID 61032213
methyl 3-[[2-(2-chloro-5-methylphenoxy)acetyl]-methylamino]propanoate (PubChem CID 61032213) has the molecular formula C14H18ClNO4 and a molecular weight of 299.75 g/mol. Its IUPAC name is methyl 3-[[2-(2-chloro-5-methylphenoxy)acetyl]-methylamino]propanoate.
| Compound Name | methyl 3-[[2-(2-chloro-5-methylphenoxy)acetyl]-methylamino]propanoate |
|---|---|
| PubChem CID | 61032213 |
| Molecular Formula | C14H18ClNO4 |
| Molecular Weight | 299.75 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | methyl 3-[[2-(2-chloro-5-methylphenoxy)acetyl]-methylamino]propanoate |
| SMILES | COC(=O)CCN(C)C(=O)COc1cc(C)ccc1Cl |
| InChI | InChI=1S/C14H18ClNO4/c1-10-4-5-11(15)12(8-10)20-9-13(17)16(2)7-6-14(18)19-3/h4-5,8H,6-7,9H2,1-3H3 |
| InChIKey | WNTQEMVYQOBNKW-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.75 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |