C14H17ClFNO4 — CID 60714443
methyl 4-[[2-(2-chloro-4-fluorophenoxy)acetyl]-methylamino]butanoate (PubChem CID 60714443) has the molecular formula C14H17ClFNO4 and a molecular weight of 317.74 g/mol. Its IUPAC name is methyl 4-[[2-(2-chloro-4-fluorophenoxy)acetyl]-methylamino]butanoate.
| Compound Name | methyl 4-[[2-(2-chloro-4-fluorophenoxy)acetyl]-methylamino]butanoate |
|---|---|
| PubChem CID | 60714443 |
| Molecular Formula | C14H17ClFNO4 |
| Molecular Weight | 317.74 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | methyl 4-[[2-(2-chloro-4-fluorophenoxy)acetyl]-methylamino]butanoate |
| SMILES | COC(=O)CCCN(C)C(=O)COc1ccc(F)cc1Cl |
| InChI | InChI=1S/C14H17ClFNO4/c1-17(7-3-4-14(19)20-2)13(18)9-21-12-6-5-10(16)8-11(12)15/h5-6,8H,3-4,7,9H2,1-2H3 |
| InChIKey | XOJUWYGUYWPVTH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.74 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |