C12H13ClFNO4 — CID 55097258
2-[[2-(2-chloro-4-fluorophenoxy)acetyl]-methylamino]propanoic acid (PubChem CID 55097258) has the molecular formula C12H13ClFNO4 and a molecular weight of 289.69 g/mol. Its IUPAC name is 2-[[2-(2-chloro-4-fluorophenoxy)acetyl]-methylamino]propanoic acid.
| Compound Name | 2-[[2-(2-chloro-4-fluorophenoxy)acetyl]-methylamino]propanoic acid |
|---|---|
| PubChem CID | 55097258 |
| Molecular Formula | C12H13ClFNO4 |
| Molecular Weight | 289.69 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 2-[[2-(2-chloro-4-fluorophenoxy)acetyl]-methylamino]propanoic acid |
| SMILES | CC(C(=O)O)N(C)C(=O)COc1ccc(F)cc1Cl |
| InChI | InChI=1S/C12H13ClFNO4/c1-7(12(17)18)15(2)11(16)6-19-10-4-3-8(14)5-9(10)13/h3-5,7H,6H2,1-2H3,(H,17,18) |
| InChIKey | IKIJJPZWYRLOII-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.69 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |