C38H34O8S2 — CID 167049907
[2-methyl-5-[3-oxo-4-(9-oxothioxanthen-3-yl)oxybutan-2-yl]oxypentan-2-yl] 2-(9-oxothioxanthen-3-yl)oxyacetate (PubChem CID 167049907) has the molecular formula C38H34O8S2 and a molecular weight of 682.82 g/mol. Its IUPAC name is [2-methyl-5-[3-oxo-4-(9-oxothioxanthen-3-yl)oxybutan-2-yl]oxypentan-2-yl] 2-(9-oxothioxanthen-3-yl)oxyacetate.
| Compound Name | [2-methyl-5-[3-oxo-4-(9-oxothioxanthen-3-yl)oxybutan-2-yl]oxypentan-2-yl] 2-(9-oxothioxanthen-3-yl)oxyacetate |
|---|---|
| PubChem CID | 167049907 |
| Molecular Formula | C38H34O8S2 |
| Molecular Weight | 682.82 g/mol |
| Exact Mass | 682.17 |
| IUPAC Name | [2-methyl-5-[3-oxo-4-(9-oxothioxanthen-3-yl)oxybutan-2-yl]oxypentan-2-yl] 2-(9-oxothioxanthen-3-yl)oxyacetate |
| SMILES | CC(OCCCC(C)(C)OC(=O)COc1ccc2c(=O)c3ccccc3sc2c1)C(=O)COc1ccc2c(=O)c3ccccc3sc2c1 |
| InChI | InChI=1S/C38H34O8S2/c1-23(30(39)21-44-24-13-15-28-33(19-24)47-31-11-6-4-9-26(31)36(28)41)43-18-8-17-38(2,3)46-35(40)22-45-25-14-16-29-34(20-25)48-32-12-7-5-10-27(32)37(29)42/h4-7,9-16,19-20,23H,8,17-18,21-22H2,1-3H3 |
| InChIKey | VOQUZPXSNDWTBP-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.82 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|