C21H28O3S2 — CID 171454428
4-(2-oxothiochromen-4-yl)sulfanylhexyl 2,2-dimethylbutanoate (PubChem CID 171454428) has the molecular formula C21H28O3S2 and a molecular weight of 392.59 g/mol. Its IUPAC name is 4-(2-oxothiochromen-4-yl)sulfanylhexyl 2,2-dimethylbutanoate.
| Compound Name | 4-(2-oxothiochromen-4-yl)sulfanylhexyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 171454428 |
| Molecular Formula | C21H28O3S2 |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 4-(2-oxothiochromen-4-yl)sulfanylhexyl 2,2-dimethylbutanoate |
| SMILES | CCC(CCCOC(=O)C(C)(C)CC)Sc1cc(=O)sc2ccccc12 |
| InChI | InChI=1S/C21H28O3S2/c1-5-15(10-9-13-24-20(23)21(3,4)6-2)25-18-14-19(22)26-17-12-8-7-11-16(17)18/h7-8,11-12,14-15H,5-6,9-10,13H2,1-4H3 |
| InChIKey | IXTQJRIDLCOUJN-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|