C25H34I2O3S2 — CID 164525175
4-(2-oxothiochromen-4-yl)sulfanylhexyl 3,5-diiodo-2,2,3,5-tetramethylhexanoate (PubChem CID 164525175) has the molecular formula C25H34I2O3S2 and a molecular weight of 700.49 g/mol. Its IUPAC name is 4-(2-oxothiochromen-4-yl)sulfanylhexyl 3,5-diiodo-2,2,3,5-tetramethylhexanoate.
| Compound Name | 4-(2-oxothiochromen-4-yl)sulfanylhexyl 3,5-diiodo-2,2,3,5-tetramethylhexanoate |
|---|---|
| PubChem CID | 164525175 |
| Molecular Formula | C25H34I2O3S2 |
| Molecular Weight | 700.49 g/mol |
| Exact Mass | 700.00 |
| IUPAC Name | 4-(2-oxothiochromen-4-yl)sulfanylhexyl 3,5-diiodo-2,2,3,5-tetramethylhexanoate |
| SMILES | CCC(CCCOC(=O)C(C)(C)C(C)(I)CC(C)(C)I)Sc1cc(=O)sc2ccccc12 |
| InChI | InChI=1S/C25H34I2O3S2/c1-7-17(31-20-15-21(28)32-19-13-9-8-12-18(19)20)11-10-14-30-22(29)24(4,5)25(6,27)16-23(2,3)26/h8-9,12-13,15,17H,7,10-11,14,16H2,1-6H3 |
| InChIKey | YDCROULNQLEIAM-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.49 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|