C23H49N3O7S2 — CID 135274059
4-[3-[3-[dimethyl(4-sulfonatobutyl)azaniumyl]propyl-(2-methylbutanoyl)amino]propyl-dimethylazaniumyl]butane-1-sulfonate (PubChem CID 135274059) has the molecular formula C23H49N3O7S2 and a molecular weight of 543.79 g/mol. Its IUPAC name is 4-[3-[3-[dimethyl(4-sulfonatobutyl)azaniumyl]propyl-(2-methylbutanoyl)amino]propyl-dimethylazaniumyl]butane-1-sulfonate.
| Compound Name | 4-[3-[3-[dimethyl(4-sulfonatobutyl)azaniumyl]propyl-(2-methylbutanoyl)amino]propyl-dimethylazaniumyl]butane-1-sulfonate |
|---|---|
| PubChem CID | 135274059 |
| Molecular Formula | C23H49N3O7S2 |
| Molecular Weight | 543.79 g/mol |
| Exact Mass | 543.30 |
| IUPAC Name | 4-[3-[3-[dimethyl(4-sulfonatobutyl)azaniumyl]propyl-(2-methylbutanoyl)amino]propyl-dimethylazaniumyl]butane-1-sulfonate |
| SMILES | CCC(C)C(=O)N(CCC[N+](C)(C)CCCCS(=O)(=O)[O-])CCC[N+](C)(C)CCCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C23H49N3O7S2/c1-7-22(2)23(27)24(14-12-18-25(3,4)16-8-10-20-34(28,29)30)15-13-19-26(5,6)17-9-11-21-35(31,32)33/h22H,7-21H2,1-6H3 |
| InChIKey | KNTGINSXNKRRMS-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 134.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.79 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|