C26H33FN2O3 — CID 134558365
2-[7-[[(1S)-1-(4-fluoro-3-propoxyphenyl)ethyl]amino]heptyl]isoindole-1,3-dione (PubChem CID 134558365) has the molecular formula C26H33FN2O3 and a molecular weight of 440.56 g/mol. Its IUPAC name is 2-[7-[[(1S)-1-(4-fluoro-3-propoxyphenyl)ethyl]amino]heptyl]isoindole-1,3-dione.
| Compound Name | 2-[7-[[(1S)-1-(4-fluoro-3-propoxyphenyl)ethyl]amino]heptyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 134558365 |
| Molecular Formula | C26H33FN2O3 |
| Molecular Weight | 440.56 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | 2-[7-[[(1S)-1-(4-fluoro-3-propoxyphenyl)ethyl]amino]heptyl]isoindole-1,3-dione |
| SMILES | CCCOc1cc([C@H](C)NCCCCCCCN2C(=O)c3ccccc3C2=O)ccc1F |
| InChI | InChI=1S/C26H33FN2O3/c1-3-17-32-24-18-20(13-14-23(24)27)19(2)28-15-9-5-4-6-10-16-29-25(30)21-11-7-8-12-22(21)26(29)31/h7-8,11-14,18-19,28H,3-6,9-10,15-17H2,1-2H3/t19-/m0/s1 |
| InChIKey | MIKTYJPSWVOHRP-IBGZPJMESA-N |
| XLogP | 5.51 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.56 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|