C20H24N2O7 — CID 8578194
methyl (2S,3S)-2-[[2-[3-(1,3-dioxoisoindol-2-yl)propanoyloxy]acetyl]amino]-3-methylpentanoate (PubChem CID 8578194) has the molecular formula C20H24N2O7 and a molecular weight of 404.42 g/mol. Its IUPAC name is methyl (2S,3S)-2-[[2-[3-(1,3-dioxoisoindol-2-yl)propanoyloxy]acetyl]amino]-3-methylpentanoate.
| Compound Name | methyl (2S,3S)-2-[[2-[3-(1,3-dioxoisoindol-2-yl)propanoyloxy]acetyl]amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 8578194 |
| Molecular Formula | C20H24N2O7 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | methyl (2S,3S)-2-[[2-[3-(1,3-dioxoisoindol-2-yl)propanoyloxy]acetyl]amino]-3-methylpentanoate |
| SMILES | CC[C@H](C)[C@H](NC(=O)COC(=O)CCN1C(=O)c2ccccc2C1=O)C(=O)OC |
| InChI | InChI=1S/C20H24N2O7/c1-4-12(2)17(20(27)28-3)21-15(23)11-29-16(24)9-10-22-18(25)13-7-5-6-8-14(13)19(22)26/h5-8,12,17H,4,9-11H2,1-3H3,(H,21,23)/t12-,17-/m0/s1 |
| InChIKey | HCYWIRLAMGGNIC-SJCJKPOMSA-N |
| XLogP | 0.92 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|