C21H18N2O7 — CID 55304763
methyl 3-[[2-[3-(1,3-dioxoisoindol-2-yl)propanoyloxy]acetyl]amino]benzoate (PubChem CID 55304763) has the molecular formula C21H18N2O7 and a molecular weight of 410.38 g/mol. Its IUPAC name is methyl 3-[[2-[3-(1,3-dioxoisoindol-2-yl)propanoyloxy]acetyl]amino]benzoate.
| Compound Name | methyl 3-[[2-[3-(1,3-dioxoisoindol-2-yl)propanoyloxy]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 55304763 |
| Molecular Formula | C21H18N2O7 |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | methyl 3-[[2-[3-(1,3-dioxoisoindol-2-yl)propanoyloxy]acetyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)COC(=O)CCN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C21H18N2O7/c1-29-21(28)13-5-4-6-14(11-13)22-17(24)12-30-18(25)9-10-23-19(26)15-7-2-3-8-16(15)20(23)27/h2-8,11H,9-10,12H2,1H3,(H,22,24) |
| InChIKey | PGBDNXJVVWNIQD-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|