C22H20N2O9S — CID 3534523
dimethyl 5-[[2-[3-(1,3-dioxoisoindol-2-yl)propanoyloxy]acetyl]amino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 3534523) has the molecular formula C22H20N2O9S and a molecular weight of 488.47 g/mol. Its IUPAC name is dimethyl 5-[[2-[3-(1,3-dioxoisoindol-2-yl)propanoyloxy]acetyl]amino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | dimethyl 5-[[2-[3-(1,3-dioxoisoindol-2-yl)propanoyloxy]acetyl]amino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 3534523 |
| Molecular Formula | C22H20N2O9S |
| Molecular Weight | 488.47 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | dimethyl 5-[[2-[3-(1,3-dioxoisoindol-2-yl)propanoyloxy]acetyl]amino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | COC(=O)c1sc(NC(=O)COC(=O)CCN2C(=O)c3ccccc3C2=O)c(C(=O)OC)c1C |
| InChI | InChI=1S/C22H20N2O9S/c1-11-16(21(29)31-2)18(34-17(11)22(30)32-3)23-14(25)10-33-15(26)8-9-24-19(27)12-6-4-5-7-13(12)20(24)28/h4-7H,8-10H2,1-3H3,(H,23,25) |
| InChIKey | XTFNWJKDULECPU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 145.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.47 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|