C34H39N3O6S — CID 3338728
ethyl 2-[11-(1,3-dioxoisoindol-2-yl)undecanoylamino]-4-methyl-5-(phenylcarbamoyl)thiophene-3-carboxylate (PubChem CID 3338728) has the molecular formula C34H39N3O6S and a molecular weight of 617.77 g/mol. Its IUPAC name is ethyl 2-[11-(1,3-dioxoisoindol-2-yl)undecanoylamino]-4-methyl-5-(phenylcarbamoyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[11-(1,3-dioxoisoindol-2-yl)undecanoylamino]-4-methyl-5-(phenylcarbamoyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 3338728 |
| Molecular Formula | C34H39N3O6S |
| Molecular Weight | 617.77 g/mol |
| Exact Mass | 617.26 |
| IUPAC Name | ethyl 2-[11-(1,3-dioxoisoindol-2-yl)undecanoylamino]-4-methyl-5-(phenylcarbamoyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CCCCCCCCCCN2C(=O)c3ccccc3C2=O)sc(C(=O)Nc2ccccc2)c1C |
| InChI | InChI=1S/C34H39N3O6S/c1-3-43-34(42)28-23(2)29(30(39)35-24-17-11-10-12-18-24)44-31(28)36-27(38)21-13-8-6-4-5-7-9-16-22-37-32(40)25-19-14-15-20-26(25)33(37)41/h10-12,14-15,17-20H,3-9,13,16,21-22H2,1-2H3,(H,35,39)(H,36,38) |
| InChIKey | AKJJNZQPLWZUGE-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.77 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|